C13H7NO — CID 59520987
N-undeca-1,3,5,7,9-pentaynylacetamide (PubChem CID 59520987) has the molecular formula C13H7NO and a molecular weight of 193.20 g/mol. Its IUPAC name is N-undeca-1,3,5,7,9-pentaynylacetamide.
| Compound Name | N-undeca-1,3,5,7,9-pentaynylacetamide |
|---|---|
| PubChem CID | 59520987 |
| Molecular Formula | C13H7NO |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | N-undeca-1,3,5,7,9-pentaynylacetamide |
| SMILES | CC#CC#CC#CC#CC#CNC(C)=O |
| InChI | InChI=1S/C13H7NO/c1-3-4-5-6-7-8-9-10-11-12-14-13(2)15/h1-2H3,(H,14,15) |
| InChIKey | KWWLOPUTZCEORD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|