C30H31O8P — CID 59521210
[(2R)-3-phosphonooxy-2-undecanoyloxypropyl] hexadeca-2,4,6,8,10,12,14-heptaynoate (PubChem CID 59521210) has the molecular formula C30H31O8P and a molecular weight of 550.54 g/mol. Its IUPAC name is [(2R)-3-phosphonooxy-2-undecanoyloxypropyl] hexadeca-2,4,6,8,10,12,14-heptaynoate.
| Compound Name | [(2R)-3-phosphonooxy-2-undecanoyloxypropyl] hexadeca-2,4,6,8,10,12,14-heptaynoate |
|---|---|
| PubChem CID | 59521210 |
| Molecular Formula | C30H31O8P |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | [(2R)-3-phosphonooxy-2-undecanoyloxypropyl] hexadeca-2,4,6,8,10,12,14-heptaynoate |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C30H31O8P/c1-3-5-7-9-11-13-14-15-16-17-19-20-22-24-29(31)36-26-28(27-37-39(33,34)35)38-30(32)25-23-21-18-12-10-8-6-4-2/h28H,4,6,8,10,12,18,21,23,25-27H2,1-2H3,(H2,33,34,35)/t28-/m1/s1 |
| InChIKey | GHIREBSYQHEPHB-MUUNZHRXSA-N |
| XLogP | 3.13 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|