C23H46NO8P — CID 59522195
[(2S)-1-(9-formyloxynonylamino)-3-phosphonooxypropan-2-yl] decanoate (PubChem CID 59522195) has the molecular formula C23H46NO8P and a molecular weight of 495.59 g/mol. Its IUPAC name is [(2S)-1-(9-formyloxynonylamino)-3-phosphonooxypropan-2-yl] decanoate.
| Compound Name | [(2S)-1-(9-formyloxynonylamino)-3-phosphonooxypropan-2-yl] decanoate |
|---|---|
| PubChem CID | 59522195 |
| Molecular Formula | C23H46NO8P |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | [(2S)-1-(9-formyloxynonylamino)-3-phosphonooxypropan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@H](CNCCCCCCCCCOC=O)COP(=O)(O)O |
| InChI | InChI=1S/C23H46NO8P/c1-2-3-4-5-7-10-13-16-23(26)32-22(20-31-33(27,28)29)19-24-17-14-11-8-6-9-12-15-18-30-21-25/h21-22,24H,2-20H2,1H3,(H2,27,28,29)/t22-/m0/s1 |
| InChIKey | RKLWOFRQADHPEF-QFIPXVFZSA-N |
| XLogP | 4.64 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|