About CID 59522631
CID 59522631 (PubChem CID 59522631) has the molecular formula C15H7F2N2Pt-
and a molecular weight of 448.31 g/mol.
Molecular Properties
| Compound Name | CID 59522631 |
| PubChem CID | 59522631 |
| Molecular Formula | C15H7F2N2Pt- |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | — |
| SMILES | FC1(F)c2cnc[c-]c2-c2nccc3cccc1c23.[Pt] |
| InChI | InChI=1S/C15H7F2N2.Pt/c16-15(17)11-3-1-2-9-4-7-19-14(13(9)11)10-5-6-18-8-12(10)15;/h1-4,6-8H;/q-1; |
| InChIKey | XMDKFRWAOUOKHG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59522631 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59522631?
The IUPAC name of CID 59522631 (CID 59522631) is not available.
What is the SMILES notation for CID 59522631?
The canonical SMILES for CID 59522631 is FC1(F)c2cnc[c-]c2-c2nccc3cccc1c23.[Pt].
What is the InChIKey of CID 59522631?
The InChIKey is XMDKFRWAOUOKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7F2N2.Pt/c16-15(17)11-3-1-2-9-4-7-19-14(13(9)11)10-5-6-18-8-12(10)15;/h1-4,6-8H;/q-1;.
What are the key properties of CID 59522631?
CID 59522631 has a molecular weight of 448.31 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59522631 is sourced from PubChem (CID 59522631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).