About CID 59522706
CID 59522706 (PubChem CID 59522706) has the molecular formula C27H14F4N2Pt
and a molecular weight of 637.49 g/mol.
Molecular Properties
| Compound Name | CID 59522706 |
| PubChem CID | 59522706 |
| Molecular Formula | C27H14F4N2Pt |
| Molecular Weight | 637.49 g/mol |
| Exact Mass | 637.07 |
| IUPAC Name | — |
| SMILES | FC1(F)c2ccc[c-]c2-c2nccc3cccc1c23.Fc1c[c-]c(-c2ccccn2)c(F)c1.[Pt+2] |
| InChI | InChI=1S/C16H8F2N.C11H6F2N.Pt/c17-16(18)12-6-2-1-5-11(12)15-14-10(8-9-19-15)4-3-7-13(14)16;12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;/h1-4,6-9H;1-4,6-7H;/q2*-1;+2 |
| InChIKey | WJFRGCYGFKAXQW-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.49 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59522706 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59522706?
The IUPAC name of CID 59522706 (CID 59522706) is not available.
What is the SMILES notation for CID 59522706?
The canonical SMILES for CID 59522706 is FC1(F)c2ccc[c-]c2-c2nccc3cccc1c23.Fc1c[c-]c(-c2ccccn2)c(F)c1.[Pt+2].
What is the InChIKey of CID 59522706?
The InChIKey is WJFRGCYGFKAXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8F2N.C11H6F2N.Pt/c17-16(18)12-6-2-1-5-11(12)15-14-10(8-9-19-15)4-3-7-13(14)16;12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;/h1-4,6-9H;1-4,6-7H;/q2*-1;+2.
What are the key properties of CID 59522706?
CID 59522706 has a molecular weight of 637.49 g/mol, XLogP of 6.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59522706 is sourced from PubChem (CID 59522706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).