About CID 59522728
CID 59522728 (PubChem CID 59522728) has the molecular formula C21H16F2IrNO2-
and a molecular weight of 544.58 g/mol.
Molecular Properties
| Compound Name | CID 59522728 |
| PubChem CID | 59522728 |
| Molecular Formula | C21H16F2IrNO2- |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.FC1(F)c2ccc[c-]c2-c2nccc3cccc1c23.[Ir] |
| InChI | InChI=1S/C16H8F2N.C5H8O2.Ir/c17-16(18)12-6-2-1-5-11(12)15-14-10(8-9-19-15)4-3-7-13(14)16;1-4(6)3-5(2)7;/h1-4,6-9H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | WNDGQJVJMYVBGX-LWFKIUJUSA-N |
| XLogP | 5.19 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59522728 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59522728?
The IUPAC name of CID 59522728 (CID 59522728) is not available.
What is the SMILES notation for CID 59522728?
The canonical SMILES for CID 59522728 is CC(=O)/C=C(/C)O.FC1(F)c2ccc[c-]c2-c2nccc3cccc1c23.[Ir].
What is the InChIKey of CID 59522728?
The InChIKey is WNDGQJVJMYVBGX-LWFKIUJUSA-N. The full InChI is InChI=1S/C16H8F2N.C5H8O2.Ir/c17-16(18)12-6-2-1-5-11(12)15-14-10(8-9-19-15)4-3-7-13(14)16;1-4(6)3-5(2)7;/h1-4,6-9H;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of CID 59522728?
CID 59522728 has a molecular weight of 544.58 g/mol, XLogP of 5.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59522728 is sourced from PubChem (CID 59522728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).