About CID 59522746
CID 59522746 (PubChem CID 59522746) has the molecular formula C28H17F3IrN2-2
and a molecular weight of 630.67 g/mol.
Molecular Properties
| Compound Name | CID 59522746 |
| PubChem CID | 59522746 |
| Molecular Formula | C28H17F3IrN2-2 |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 631.10 |
| IUPAC Name | — |
| SMILES | Cc1c(F)c[c-]c2c1C(F)(F)c1cccc3ccnc-2c13.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C17H9F3N.C11H8N.Ir/c1-9-13(18)6-5-11-15(9)17(19,20)12-4-2-3-10-7-8-21-16(11)14(10)12;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-4,6-8H,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | UXUWBUIOYGHZER-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59522746 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59522746?
The IUPAC name of CID 59522746 (CID 59522746) is not available.
What is the SMILES notation for CID 59522746?
The canonical SMILES for CID 59522746 is Cc1c(F)c[c-]c2c1C(F)(F)c1cccc3ccnc-2c13.[Ir].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of CID 59522746?
The InChIKey is UXUWBUIOYGHZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9F3N.C11H8N.Ir/c1-9-13(18)6-5-11-15(9)17(19,20)12-4-2-3-10-7-8-21-16(11)14(10)12;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-4,6-8H,1H3;1-6,8-9H;/q2*-1;.
What are the key properties of CID 59522746?
CID 59522746 has a molecular weight of 630.67 g/mol, XLogP of 7.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59522746 is sourced from PubChem (CID 59522746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).