About N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine
N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine (PubChem CID 59522795) has the molecular formula C18H22N4
and a molecular weight of 294.40 g/mol. Its IUPAC name is N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine |
| PubChem CID | 59522795 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine |
| SMILES | CN1CCC[C@H]1c1cnc2c(c1)c1ccccc1n2N(C)C |
| InChI | InChI=1S/C18H22N4/c1-20(2)22-17-8-5-4-7-14(17)15-11-13(12-19-18(15)22)16-9-6-10-21(16)3/h4-5,7-8,11-12,16H,6,9-10H2,1-3H3/t16-/m0/s1 |
| InChIKey | WTJVIZKOELJXNQ-INIZCTEOSA-N |
| XLogP | 3.15 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine?
The IUPAC name of N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine (CID 59522795) is N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine.
What is the SMILES notation for N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine?
The canonical SMILES for N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine is CN1CCC[C@H]1c1cnc2c(c1)c1ccccc1n2N(C)C.
What is the InChIKey of N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine?
The InChIKey is WTJVIZKOELJXNQ-INIZCTEOSA-N. The full InChI is InChI=1S/C18H22N4/c1-20(2)22-17-8-5-4-7-14(17)15-11-13(12-19-18(15)22)16-9-6-10-21(16)3/h4-5,7-8,11-12,16H,6,9-10H2,1-3H3/t16-/m0/s1.
What are the key properties of N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine?
N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine has a molecular weight of 294.40 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyrido[2,3-b]indol-9-amine is sourced from PubChem (CID 59522795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).