About 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine
5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine (PubChem CID 59522828) has the molecular formula C13H16N4O
and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine.
Molecular Properties
| Compound Name | 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine |
| PubChem CID | 59522828 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine |
| SMILES | COc1ncc([C@@H]2CCCN2C)c2nnccc12 |
| InChI | InChI=1S/C13H16N4O/c1-17-7-3-4-11(17)10-8-14-13(18-2)9-5-6-15-16-12(9)10/h5-6,8,11H,3-4,7H2,1-2H3/t11-/m0/s1 |
| InChIKey | OWBREFHZHFQKIT-NSHDSACASA-N |
| XLogP | 1.80 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine?
The IUPAC name of 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine (CID 59522828) is 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine.
What is the SMILES notation for 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine?
The canonical SMILES for 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine is COc1ncc([C@@H]2CCCN2C)c2nnccc12.
What is the InChIKey of 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine?
The InChIKey is OWBREFHZHFQKIT-NSHDSACASA-N. The full InChI is InChI=1S/C13H16N4O/c1-17-7-3-4-11(17)10-8-14-13(18-2)9-5-6-15-16-12(9)10/h5-6,8,11H,3-4,7H2,1-2H3/t11-/m0/s1.
What are the key properties of 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine?
5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine has a molecular weight of 244.30 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-8-[(2S)-1-methylpyrrolidin-2-yl]pyrido[4,3-c]pyridazine is sourced from PubChem (CID 59522828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).