About 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole
3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole (PubChem CID 59522850) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole |
| PubChem CID | 59522850 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole |
| SMILES | CN1CCC[C@H]1c1cnc2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C16H17N3/c1-19-8-4-7-15(19)11-9-13-12-5-2-3-6-14(12)18-16(13)17-10-11/h2-3,5-6,9-10,15H,4,7-8H2,1H3,(H,17,18)/t15-/m0/s1 |
| InChIKey | SRBZUOQRERIWAG-HNNXBMFYSA-N |
| XLogP | 3.48 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole?
The IUPAC name of 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole (CID 59522850) is 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole?
The canonical SMILES for 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole is CN1CCC[C@H]1c1cnc2[nH]c3ccccc3c2c1.
What is the InChIKey of 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole?
The InChIKey is SRBZUOQRERIWAG-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H17N3/c1-19-8-4-7-15(19)11-9-13-12-5-2-3-6-14(12)18-16(13)17-10-11/h2-3,5-6,9-10,15H,4,7-8H2,1H3,(H,17,18)/t15-/m0/s1.
What are the key properties of 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole?
3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole has a molecular weight of 251.33 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-1-methylpyrrolidin-2-yl]-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 59522850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).