About lithium 2-pyridin-2-ylphenolate
lithium 2-pyridin-2-ylphenolate (PubChem CID 59522969) has the molecular formula C11H8LiNO
and a molecular weight of 177.13 g/mol. Its IUPAC name is lithium 2-pyridin-2-ylphenolate.
Molecular Properties
| Compound Name | lithium 2-pyridin-2-ylphenolate |
| PubChem CID | 59522969 |
| Molecular Formula | C11H8LiNO |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | lithium 2-pyridin-2-ylphenolate |
| SMILES | [Li+].[O-]c1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H9NO.Li/c13-11-7-2-1-5-9(11)10-6-3-4-8-12-10;/h1-8,13H;/q;+1/p-1 |
| InChIKey | PSAFWEIHLJUJOI-UHFFFAOYSA-M |
| XLogP | -1.17 |
| TPSA | 35.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium 2-pyridin-2-ylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-pyridin-2-ylphenolate?
The IUPAC name of lithium 2-pyridin-2-ylphenolate (CID 59522969) is lithium 2-pyridin-2-ylphenolate.
What is the SMILES notation for lithium 2-pyridin-2-ylphenolate?
The canonical SMILES for lithium 2-pyridin-2-ylphenolate is [Li+].[O-]c1ccccc1-c1ccccn1.
What is the InChIKey of lithium 2-pyridin-2-ylphenolate?
The InChIKey is PSAFWEIHLJUJOI-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H9NO.Li/c13-11-7-2-1-5-9(11)10-6-3-4-8-12-10;/h1-8,13H;/q;+1/p-1.
What are the key properties of lithium 2-pyridin-2-ylphenolate?
lithium 2-pyridin-2-ylphenolate has a molecular weight of 177.13 g/mol, XLogP of -1.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-pyridin-2-ylphenolate is sourced from PubChem (CID 59522969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).