C17H28N8O3 — CID 59522990
N-[[[4-[ethyl(methyl)amino]-6-[methoxymethyl-[[(3-methylideneoxiran-2-yl)amino]methyl]amino]-1,3,5-triazin-2-yl]-methylamino]methyl]prop-2-enamide (PubChem CID 59522990) has the molecular formula C17H28N8O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[[[4-[ethyl(methyl)amino]-6-[methoxymethyl-[[(3-methylideneoxiran-2-yl)amino]methyl]amino]-1,3,5-triazin-2-yl]-methylamino]methyl]prop-2-enamide.
| Compound Name | N-[[[4-[ethyl(methyl)amino]-6-[methoxymethyl-[[(3-methylideneoxiran-2-yl)amino]methyl]amino]-1,3,5-triazin-2-yl]-methylamino]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 59522990 |
| Molecular Formula | C17H28N8O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | N-[[[4-[ethyl(methyl)amino]-6-[methoxymethyl-[[(3-methylideneoxiran-2-yl)amino]methyl]amino]-1,3,5-triazin-2-yl]-methylamino]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCN(C)c1nc(N(C)CC)nc(N(CNC2OC2=C)COC)n1 |
| InChI | InChI=1S/C17H28N8O3/c1-7-13(26)18-9-24(5)16-20-15(23(4)8-2)21-17(22-16)25(11-27-6)10-19-14-12(3)28-14/h7,14,19H,1,3,8-11H2,2,4-6H3,(H,18,26) |
| InChIKey | HGXOLOHUFMNYKZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|