About 2,5-dibromothiophene-3,4-dicarbonitrile
2,5-dibromothiophene-3,4-dicarbonitrile (PubChem CID 59523037) has the molecular formula C6Br2N2S
and a molecular weight of 291.96 g/mol. Its IUPAC name is 2,5-dibromothiophene-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2,5-dibromothiophene-3,4-dicarbonitrile |
| PubChem CID | 59523037 |
| Molecular Formula | C6Br2N2S |
| Molecular Weight | 291.96 g/mol |
| Exact Mass | 289.81 |
| IUPAC Name | 2,5-dibromothiophene-3,4-dicarbonitrile |
| SMILES | N#Cc1c(Br)sc(Br)c1C#N |
| InChI | InChI=1S/C6Br2N2S/c7-5-3(1-9)4(2-10)6(8)11-5 |
| InChIKey | TUSNKPAYLNZNIL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.96 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dibromothiophene-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromothiophene-3,4-dicarbonitrile?
The IUPAC name of 2,5-dibromothiophene-3,4-dicarbonitrile (CID 59523037) is 2,5-dibromothiophene-3,4-dicarbonitrile.
What is the SMILES notation for 2,5-dibromothiophene-3,4-dicarbonitrile?
The canonical SMILES for 2,5-dibromothiophene-3,4-dicarbonitrile is N#Cc1c(Br)sc(Br)c1C#N.
What is the InChIKey of 2,5-dibromothiophene-3,4-dicarbonitrile?
The InChIKey is TUSNKPAYLNZNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6Br2N2S/c7-5-3(1-9)4(2-10)6(8)11-5.
What are the key properties of 2,5-dibromothiophene-3,4-dicarbonitrile?
2,5-dibromothiophene-3,4-dicarbonitrile has a molecular weight of 291.96 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromothiophene-3,4-dicarbonitrile is sourced from PubChem (CID 59523037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).