About 4-methoxy-1-methylindole
4-methoxy-1-methylindole (PubChem CID 595238) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 4-methoxy-1-methylindole.
Molecular Properties
| Compound Name | 4-methoxy-1-methylindole |
| PubChem CID | 595238 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 4-methoxy-1-methylindole |
| SMILES | COc1cccc2c1ccn2C |
| InChI | InChI=1S/C10H11NO/c1-11-7-6-8-9(11)4-3-5-10(8)12-2/h3-7H,1-2H3 |
| InChIKey | ATEWBFOJLQMYEA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-methylindole?
The IUPAC name of 4-methoxy-1-methylindole (CID 595238) is 4-methoxy-1-methylindole.
What is the SMILES notation for 4-methoxy-1-methylindole?
The canonical SMILES for 4-methoxy-1-methylindole is COc1cccc2c1ccn2C.
What is the InChIKey of 4-methoxy-1-methylindole?
The InChIKey is ATEWBFOJLQMYEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-11-7-6-8-9(11)4-3-5-10(8)12-2/h3-7H,1-2H3.
What are the key properties of 4-methoxy-1-methylindole?
4-methoxy-1-methylindole has a molecular weight of 161.20 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-methylindole is sourced from PubChem (CID 595238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).