About 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide
6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 59523869) has the molecular formula C21H18BrO4P
and a molecular weight of 445.25 g/mol. Its IUPAC name is 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide.
Molecular Properties
| Compound Name | 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide |
| PubChem CID | 59523869 |
| Molecular Formula | C21H18BrO4P |
| Molecular Weight | 445.25 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | COc1cc(P2(=O)Oc3ccccc3-c3ccccc32)c(OC)cc1CBr |
| InChI | InChI=1S/C21H18BrO4P/c1-24-18-12-21(19(25-2)11-14(18)13-22)27(23)20-10-6-4-8-16(20)15-7-3-5-9-17(15)26-27/h3-12H,13H2,1-2H3 |
| InChIKey | JEHWKOKUWZYYIX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide?
The IUPAC name of 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide (CID 59523869) is 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide.
What is the SMILES notation for 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide?
The canonical SMILES for 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide is COc1cc(P2(=O)Oc3ccccc3-c3ccccc32)c(OC)cc1CBr.
What is the InChIKey of 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide?
The InChIKey is JEHWKOKUWZYYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18BrO4P/c1-24-18-12-21(19(25-2)11-14(18)13-22)27(23)20-10-6-4-8-16(20)15-7-3-5-9-17(15)26-27/h3-12H,13H2,1-2H3.
What are the key properties of 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide?
6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide has a molecular weight of 445.25 g/mol, XLogP of 4.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(bromomethyl)-2,5-dimethoxyphenyl]benzo[c][2,1]benzoxaphosphinine 6-oxide is sourced from PubChem (CID 59523869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).