C32H38N2 — CID 59523991
4-N-cyclohexa-1,5-dien-1-yl-1-N-cyclohexa-2,4-dien-1-yl-4-N-[(3E,5E)-hepta-1,3,5-trien-3-yl]-1-N-(4-methylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-diene-1,4-diamine (PubChem CID 59523991) has the molecular formula C32H38N2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 4-N-cyclohexa-1,5-dien-1-yl-1-N-cyclohexa-2,4-dien-1-yl-4-N-[(3E,5E)-hepta-1,3,5-trien-3-yl]-1-N-(4-methylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-diene-1,4-diamine.
| Compound Name | 4-N-cyclohexa-1,5-dien-1-yl-1-N-cyclohexa-2,4-dien-1-yl-4-N-[(3E,5E)-hepta-1,3,5-trien-3-yl]-1-N-(4-methylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 59523991 |
| Molecular Formula | C32H38N2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 4-N-cyclohexa-1,5-dien-1-yl-1-N-cyclohexa-2,4-dien-1-yl-4-N-[(3E,5E)-hepta-1,3,5-trien-3-yl]-1-N-(4-methylcyclohexa-1,5-dien-1-yl)cyclohexa-1,3-diene-1,4-diamine |
| SMILES | C=C/C(=C\C=C\C)N(C1=CCCC=C1)C1=CC=C(N(C2=CCC(C)C=C2)C2C=CC=CC2)CC1 |
| InChI | InChI=1S/C32H38N2/c1-4-6-13-27(5-2)33(28-14-9-7-10-15-28)31-22-24-32(25-23-31)34(29-16-11-8-12-17-29)30-20-18-26(3)19-21-30/h4-6,8-9,11-16,18,20-22,24,26,29H,2,7,10,17,19,23,25H2,1,3H3/b6-4+,27-13+ |
| InChIKey | JRACJTFMIFTYPL-BFRRXCIKSA-N |
| XLogP | 8.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|