C38H40N2 — CID 59523996
4-N-(4a,8a-dihydronaphthalen-2-yl)-4-N-cyclohexa-2,4-dien-1-yl-1-N-(2,3-dihydronaphthalen-2-yl)-1-N-[(1E)-hexa-1,5-dienyl]cyclohexa-1,3-diene-1,4-diamine (PubChem CID 59523996) has the molecular formula C38H40N2 and a molecular weight of 524.75 g/mol. Its IUPAC name is 4-N-(4a,8a-dihydronaphthalen-2-yl)-4-N-cyclohexa-2,4-dien-1-yl-1-N-(2,3-dihydronaphthalen-2-yl)-1-N-[(1E)-hexa-1,5-dienyl]cyclohexa-1,3-diene-1,4-diamine.
| Compound Name | 4-N-(4a,8a-dihydronaphthalen-2-yl)-4-N-cyclohexa-2,4-dien-1-yl-1-N-(2,3-dihydronaphthalen-2-yl)-1-N-[(1E)-hexa-1,5-dienyl]cyclohexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 59523996 |
| Molecular Formula | C38H40N2 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 4-N-(4a,8a-dihydronaphthalen-2-yl)-4-N-cyclohexa-2,4-dien-1-yl-1-N-(2,3-dihydronaphthalen-2-yl)-1-N-[(1E)-hexa-1,5-dienyl]cyclohexa-1,3-diene-1,4-diamine |
| SMILES | C=CCC/C=C/N(C1=CC=C(N(C2=CC3C=CC=CC3C=C2)C2C=CC=CC2)CC1)C1C=c2ccccc2=CC1 |
| InChI | InChI=1S/C38H40N2/c1-2-3-4-12-27-39(37-21-19-30-13-8-10-15-32(30)28-37)34-23-25-36(26-24-34)40(35-17-6-5-7-18-35)38-22-20-31-14-9-11-16-33(31)29-38/h2,5-17,19-20,22-23,25,27-29,31,33,35,37H,1,3-4,18,21,24,26H2/b27-12+ |
| InChIKey | CBKBYEIHZKAWCS-KKMKTNMSSA-N |
| XLogP | 7.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|