C21H28F12O4S — CID 59524493
3-methoxypropyl 4-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononylsulfanylcarbonyl)-2-methylhexanoate (PubChem CID 59524493) has the molecular formula C21H28F12O4S and a molecular weight of 604.49 g/mol. Its IUPAC name is 3-methoxypropyl 4-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononylsulfanylcarbonyl)-2-methylhexanoate.
| Compound Name | 3-methoxypropyl 4-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononylsulfanylcarbonyl)-2-methylhexanoate |
|---|---|
| PubChem CID | 59524493 |
| Molecular Formula | C21H28F12O4S |
| Molecular Weight | 604.49 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | 3-methoxypropyl 4-(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononylsulfanylcarbonyl)-2-methylhexanoate |
| SMILES | CCC(CC(C)C(=O)OCCCOC)C(=O)SCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C21H28F12O4S/c1-4-13(11-12(2)14(34)37-9-6-8-36-3)15(35)38-10-5-7-17(24,25)19(28,29)21(32,33)20(30,31)18(26,27)16(22)23/h12-13,16H,4-11H2,1-3H3 |
| InChIKey | NDCLIWBOLKSIHH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.49 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|