About 4-ethenylnaphthalen-1-ol;yttrium
4-ethenylnaphthalen-1-ol;yttrium (PubChem CID 59524551) has the molecular formula C12H10OY
and a molecular weight of 259.12 g/mol. Its IUPAC name is 4-ethenylnaphthalen-1-ol;yttrium.
Molecular Properties
| Compound Name | 4-ethenylnaphthalen-1-ol;yttrium |
| PubChem CID | 59524551 |
| Molecular Formula | C12H10OY |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 4-ethenylnaphthalen-1-ol;yttrium |
| SMILES | C=Cc1ccc(O)c2ccccc12.[Y] |
| InChI | InChI=1S/C12H10O.Y/c1-2-9-7-8-12(13)11-6-4-3-5-10(9)11;/h2-8,13H,1H2; |
| InChIKey | NJDBCHRMGPZJIY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenylnaphthalen-1-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylnaphthalen-1-ol;yttrium?
The IUPAC name of 4-ethenylnaphthalen-1-ol;yttrium (CID 59524551) is 4-ethenylnaphthalen-1-ol;yttrium.
What is the SMILES notation for 4-ethenylnaphthalen-1-ol;yttrium?
The canonical SMILES for 4-ethenylnaphthalen-1-ol;yttrium is C=Cc1ccc(O)c2ccccc12.[Y].
What is the InChIKey of 4-ethenylnaphthalen-1-ol;yttrium?
The InChIKey is NJDBCHRMGPZJIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.Y/c1-2-9-7-8-12(13)11-6-4-3-5-10(9)11;/h2-8,13H,1H2;.
What are the key properties of 4-ethenylnaphthalen-1-ol;yttrium?
4-ethenylnaphthalen-1-ol;yttrium has a molecular weight of 259.12 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylnaphthalen-1-ol;yttrium is sourced from PubChem (CID 59524551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).