C9H13F6NO4S2 — CID 59524591
1-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonylpiperidine (PubChem CID 59524591) has the molecular formula C9H13F6NO4S2 and a molecular weight of 377.33 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonylpiperidine.
| Compound Name | 1-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 59524591 |
| Molecular Formula | C9H13F6NO4S2 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonylpiperidine |
| SMILES | CS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H13F6NO4S2/c1-21(17,18)8(12,13)7(10,11)9(14,15)22(19,20)16-5-3-2-4-6-16/h2-6H2,1H3 |
| InChIKey | MIUQWSMXVDGRQG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|