C15H14O3Y — CID 59524611
(6-hydroxynaphthalen-2-yl)methyl 2-methylprop-2-enoate;yttrium (PubChem CID 59524611) has the molecular formula C15H14O3Y and a molecular weight of 331.18 g/mol. Its IUPAC name is (6-hydroxynaphthalen-2-yl)methyl 2-methylprop-2-enoate;yttrium.
| Compound Name | (6-hydroxynaphthalen-2-yl)methyl 2-methylprop-2-enoate;yttrium |
|---|---|
| PubChem CID | 59524611 |
| Molecular Formula | C15H14O3Y |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | (6-hydroxynaphthalen-2-yl)methyl 2-methylprop-2-enoate;yttrium |
| SMILES | C=C(C)C(=O)OCc1ccc2cc(O)ccc2c1.[Y] |
| InChI | InChI=1S/C15H14O3.Y/c1-10(2)15(17)18-9-11-3-4-13-8-14(16)6-5-12(13)7-11;/h3-8,16H,1,9H2,2H3; |
| InChIKey | XKBYESKGBMPKIX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|