C9H8F2O4S — CID 59524676
1,1-difluoro-2-(4-oxo-5-tetracyclo[3.2.0.01,3.02,7]heptanyl)ethanesulfonic acid (PubChem CID 59524676) has the molecular formula C9H8F2O4S and a molecular weight of 250.22 g/mol. Its IUPAC name is 1,1-difluoro-2-(4-oxo-5-tetracyclo[3.2.0.01,3.02,7]heptanyl)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(4-oxo-5-tetracyclo[3.2.0.01,3.02,7]heptanyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 59524676 |
| Molecular Formula | C9H8F2O4S |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1,1-difluoro-2-(4-oxo-5-tetracyclo[3.2.0.01,3.02,7]heptanyl)ethanesulfonic acid |
| SMILES | O=C1C2C3C4CC1(CC(F)(F)S(=O)(=O)O)C423 |
| InChI | InChI=1S/C9H8F2O4S/c10-8(11,16(13,14)15)2-7-1-3-4-5(6(7)12)9(3,4)7/h3-5H,1-2H2,(H,13,14,15) |
| InChIKey | OVTDJAYUSWBZJF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|