C14H13BN2O4 — CID 59525424
1-(1-hydroxy-6-pyrazin-2-yloxy-3H-2,1-benzoxaborol-3-yl)propan-2-one (PubChem CID 59525424) has the molecular formula C14H13BN2O4 and a molecular weight of 284.08 g/mol. Its IUPAC name is 1-(1-hydroxy-6-pyrazin-2-yloxy-3H-2,1-benzoxaborol-3-yl)propan-2-one.
| Compound Name | 1-(1-hydroxy-6-pyrazin-2-yloxy-3H-2,1-benzoxaborol-3-yl)propan-2-one |
|---|---|
| PubChem CID | 59525424 |
| Molecular Formula | C14H13BN2O4 |
| Molecular Weight | 284.08 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-(1-hydroxy-6-pyrazin-2-yloxy-3H-2,1-benzoxaborol-3-yl)propan-2-one |
| SMILES | CC(=O)CC1OB(O)c2cc(Oc3cnccn3)ccc21 |
| InChI | InChI=1S/C14H13BN2O4/c1-9(18)6-13-11-3-2-10(7-12(11)15(19)21-13)20-14-8-16-4-5-17-14/h2-5,7-8,13,19H,6H2,1H3 |
| InChIKey | LKVFIOOSRAUCOE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.08 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|