About 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine
3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine (PubChem CID 59525706) has the molecular formula C7H6ClF2N3
and a molecular weight of 205.59 g/mol. Its IUPAC name is 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine.
Molecular Properties
| Compound Name | 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine |
| PubChem CID | 59525706 |
| Molecular Formula | C7H6ClF2N3 |
| Molecular Weight | 205.59 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine |
| SMILES | FC1(F)CN(c2ccc(Cl)nn2)C1 |
| InChI | InChI=1S/C7H6ClF2N3/c8-5-1-2-6(12-11-5)13-3-7(9,10)4-13/h1-2H,3-4H2 |
| InChIKey | NLOMVZSKNOZHGL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.59 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine?
The IUPAC name of 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine (CID 59525706) is 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine.
What is the SMILES notation for 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine?
The canonical SMILES for 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine is FC1(F)CN(c2ccc(Cl)nn2)C1.
What is the InChIKey of 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine?
The InChIKey is NLOMVZSKNOZHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClF2N3/c8-5-1-2-6(12-11-5)13-3-7(9,10)4-13/h1-2H,3-4H2.
What are the key properties of 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine?
3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine has a molecular weight of 205.59 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-(3,3-difluoroazetidin-1-yl)pyridazine is sourced from PubChem (CID 59525706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).