About 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine
2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine (PubChem CID 59525831) has the molecular formula C11H13ClF2N2
and a molecular weight of 246.69 g/mol. Its IUPAC name is 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine.
Molecular Properties
| Compound Name | 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine |
| PubChem CID | 59525831 |
| Molecular Formula | C11H13ClF2N2 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine |
| SMILES | FC1(F)CCN(Cc2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C11H13ClF2N2/c12-10-2-1-9(7-15-10)8-16-5-3-11(13,14)4-6-16/h1-2,7H,3-6,8H2 |
| InChIKey | HMIJOXHNCGGLLT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine?
The IUPAC name of 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine (CID 59525831) is 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine.
What is the SMILES notation for 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine?
The canonical SMILES for 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine is FC1(F)CCN(Cc2ccc(Cl)nc2)CC1.
What is the InChIKey of 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine?
The InChIKey is HMIJOXHNCGGLLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClF2N2/c12-10-2-1-9(7-15-10)8-16-5-3-11(13,14)4-6-16/h1-2,7H,3-6,8H2.
What are the key properties of 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine?
2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine has a molecular weight of 246.69 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(4,4-difluoropiperidin-1-yl)methyl]pyridine is sourced from PubChem (CID 59525831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).