About 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol
1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol (PubChem CID 59526148) has the molecular formula C6H4ClF3N2O
and a molecular weight of 212.56 g/mol. Its IUPAC name is 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol |
| PubChem CID | 59526148 |
| Molecular Formula | C6H4ClF3N2O |
| Molecular Weight | 212.56 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol |
| SMILES | OC(c1nccc(Cl)n1)C(F)(F)F |
| InChI | InChI=1S/C6H4ClF3N2O/c7-3-1-2-11-5(12-3)4(13)6(8,9)10/h1-2,4,13H |
| InChIKey | ISGWZNWZUUWORW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.56 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol?
The IUPAC name of 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol (CID 59526148) is 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol.
What is the SMILES notation for 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol?
The canonical SMILES for 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol is OC(c1nccc(Cl)n1)C(F)(F)F.
What is the InChIKey of 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol?
The InChIKey is ISGWZNWZUUWORW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClF3N2O/c7-3-1-2-11-5(12-3)4(13)6(8,9)10/h1-2,4,13H.
What are the key properties of 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol?
1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol has a molecular weight of 212.56 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloropyrimidin-2-yl)-2,2,2-trifluoroethanol is sourced from PubChem (CID 59526148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).