C18H16Cl2N2O3 — CID 59526484
(E)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-methyl-2-pyridinyl)prop-2-en-1-one (PubChem CID 59526484) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is (E)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-methyl-2-pyridinyl)prop-2-en-1-one.
| Compound Name | (E)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-methyl-2-pyridinyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59526484 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (E)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-methyl-2-pyridinyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCc3c(Cl)c(O)c(O)c(Cl)c3C2)nc1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-10-2-3-11(21-8-10)4-5-14(23)22-7-6-12-13(9-22)16(20)18(25)17(24)15(12)19/h2-5,8,24-25H,6-7,9H2,1H3/b5-4+ |
| InChIKey | XBXKYEIMIKCEBP-SNAWJCMRSA-N |
| XLogP | 3.71 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|