C20H20F5N2O+ — CID 59526590
2-(6-fluoro-1H-indol-3-yl)ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium (PubChem CID 59526590) has the molecular formula C20H20F5N2O+ and a molecular weight of 399.38 g/mol. Its IUPAC name is 2-(6-fluoro-1H-indol-3-yl)ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium.
| Compound Name | 2-(6-fluoro-1H-indol-3-yl)ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 59526590 |
| Molecular Formula | C20H20F5N2O+ |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-(6-fluoro-1H-indol-3-yl)ethyl-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]azanium |
| SMILES | Fc1ccc2c(CC[NH2+]Cc3cccc(OCC(F)(F)C(F)F)c3)c[nH]c2c1 |
| InChI | InChI=1S/C20H19F5N2O/c21-15-4-5-17-14(11-27-18(17)9-15)6-7-26-10-13-2-1-3-16(8-13)28-12-20(24,25)19(22)23/h1-5,8-9,11,19,26-27H,6-7,10,12H2/p+1 |
| InChIKey | YBAWYTYNMZWMMJ-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|