About (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate
(3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate (PubChem CID 59527158) has the molecular formula C16H18N2O4
and a molecular weight of 302.33 g/mol. Its IUPAC name is (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate |
| PubChem CID | 59527158 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate |
| SMILES | Cc1c(COC(=O)N2CCOCC2)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C16H18N2O4/c1-11-14(10-22-16(20)18-6-8-21-9-7-18)17-13-5-3-2-4-12(13)15(11)19/h2-5H,6-10H2,1H3,(H,17,19) |
| InChIKey | NNAYMKIWFQKWRG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate?
The IUPAC name of (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate (CID 59527158) is (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate.
What is the SMILES notation for (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate?
The canonical SMILES for (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate is Cc1c(COC(=O)N2CCOCC2)[nH]c2ccccc2c1=O.
What is the InChIKey of (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate?
The InChIKey is NNAYMKIWFQKWRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4/c1-11-14(10-22-16(20)18-6-8-21-9-7-18)17-13-5-3-2-4-12(13)15(11)19/h2-5H,6-10H2,1H3,(H,17,19).
What are the key properties of (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate?
(3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate has a molecular weight of 302.33 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-4-oxo-1H-quinolin-2-yl)methyl morpholine-4-carboxylate is sourced from PubChem (CID 59527158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).