About 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline
2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline (PubChem CID 59527668) has the molecular formula C15H19FN4
and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline.
Molecular Properties
| Compound Name | 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline |
| PubChem CID | 59527668 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline |
| SMILES | CC1CN(c2ncc3cc(F)ccc3n2)CCNC1C |
| InChI | InChI=1S/C15H19FN4/c1-10-9-20(6-5-17-11(10)2)15-18-8-12-7-13(16)3-4-14(12)19-15/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3 |
| InChIKey | TZQWQNHJTVAMCX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline?
The IUPAC name of 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline (CID 59527668) is 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline.
What is the SMILES notation for 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline?
The canonical SMILES for 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline is CC1CN(c2ncc3cc(F)ccc3n2)CCNC1C.
What is the InChIKey of 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline?
The InChIKey is TZQWQNHJTVAMCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN4/c1-10-9-20(6-5-17-11(10)2)15-18-8-12-7-13(16)3-4-14(12)19-15/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3.
What are the key properties of 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline?
2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline has a molecular weight of 274.34 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethyl-1,4-diazepan-1-yl)-6-fluoroquinazoline is sourced from PubChem (CID 59527668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).