About CID 59528212
CID 59528212 (PubChem CID 59528212) has the molecular formula C13H14FNO
and a molecular weight of 219.26 g/mol.
Molecular Properties
| Compound Name | CID 59528212 |
| PubChem CID | 59528212 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | — |
| SMILES | [CH]N1CCC2(CC1)COc1ccc(F)cc12 |
| InChI | InChI=1S/C13H14FNO/c1-15-6-4-13(5-7-15)9-16-12-3-2-10(14)8-11(12)13/h1-3,8H,4-7,9H2 |
| InChIKey | USOUPKGUDSFJTI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59528212 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59528212?
The IUPAC name of CID 59528212 (CID 59528212) is not available.
What is the SMILES notation for CID 59528212?
The canonical SMILES for CID 59528212 is [CH]N1CCC2(CC1)COc1ccc(F)cc12.
What is the InChIKey of CID 59528212?
The InChIKey is USOUPKGUDSFJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FNO/c1-15-6-4-13(5-7-15)9-16-12-3-2-10(14)8-11(12)13/h1-3,8H,4-7,9H2.
What are the key properties of CID 59528212?
CID 59528212 has a molecular weight of 219.26 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59528212 is sourced from PubChem (CID 59528212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).