C27H34N4O2 — CID 59528999
(E)-3-[2-[[[(2E)-2-ethenylpenta-2,4-dienyl]-[(2E)-hepta-2,6-dienyl]amino]methyl]-1-ethylbenzimidazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 59528999) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is (E)-3-[2-[[[(2E)-2-ethenylpenta-2,4-dienyl]-[(2E)-hepta-2,6-dienyl]amino]methyl]-1-ethylbenzimidazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-[[[(2E)-2-ethenylpenta-2,4-dienyl]-[(2E)-hepta-2,6-dienyl]amino]methyl]-1-ethylbenzimidazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 59528999 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (E)-3-[2-[[[(2E)-2-ethenylpenta-2,4-dienyl]-[(2E)-hepta-2,6-dienyl]amino]methyl]-1-ethylbenzimidazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | C=C/C=C(\C=C)CN(C/C=C/CCC=C)Cc1nc2cc(/C=C/C(=O)NO)ccc2n1CC |
| InChI | InChI=1S/C27H34N4O2/c1-5-9-10-11-12-18-30(20-22(7-3)13-6-2)21-26-28-24-19-23(15-17-27(32)29-33)14-16-25(24)31(26)8-4/h5-7,11-17,19,33H,1-3,8-10,18,20-21H2,4H3,(H,29,32)/b12-11+,17-15+,22-13+ |
| InChIKey | CZECKUYEHYMTCJ-XQMZAMDJSA-N |
| XLogP | 5.20 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|