C24H27ClF3NO3 — CID 59529018
[4-chloro-3-(trifluoromethyl)phenyl] (4aR,8S,8aR)-2-(cyclohexylmethyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate (PubChem CID 59529018) has the molecular formula C24H27ClF3NO3 and a molecular weight of 469.93 g/mol. Its IUPAC name is [4-chloro-3-(trifluoromethyl)phenyl] (4aR,8S,8aR)-2-(cyclohexylmethyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate.
| Compound Name | [4-chloro-3-(trifluoromethyl)phenyl] (4aR,8S,8aR)-2-(cyclohexylmethyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 59529018 |
| Molecular Formula | C24H27ClF3NO3 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [4-chloro-3-(trifluoromethyl)phenyl] (4aR,8S,8aR)-2-(cyclohexylmethyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)c(C(F)(F)F)c1)[C@H]1CC=C[C@H]2CCN(CC3CCCCC3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C24H27ClF3NO3/c25-20-10-9-17(13-19(20)24(26,27)28)32-23(31)18-8-4-7-16-11-12-29(22(30)21(16)18)14-15-5-2-1-3-6-15/h4,7,9-10,13,15-16,18,21H,1-3,5-6,8,11-12,14H2/t16-,18-,21+/m0/s1 |
| InChIKey | ULKOQJBSZNVJFC-DJPFJPOOSA-N |
| XLogP | 5.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|