C11H14O3 — CID 595292
1,5-dimethoxybicyclo[3.2.2]nona-3,6-dien-2-one (PubChem CID 595292) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1,5-dimethoxybicyclo[3.2.2]nona-3,6-dien-2-one.
| Compound Name | 1,5-dimethoxybicyclo[3.2.2]nona-3,6-dien-2-one |
|---|---|
| PubChem CID | 595292 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1,5-dimethoxybicyclo[3.2.2]nona-3,6-dien-2-one |
| SMILES | COC12C=CC(=O)C(OC)(C=C1)CC2 |
| InChI | InChI=1S/C11H14O3/c1-13-10-4-3-9(12)11(14-2,7-5-10)8-6-10/h3-5,7H,6,8H2,1-2H3 |
| InChIKey | QKDCVYQPVBIIQG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|