C15H31N5 — CID 59529658
(2R,3R,11R,12R,15Z)-2,3,11,12-tetramethyl-1,4,7,10,13-pentazacyclohexadeca-13,15-diene (PubChem CID 59529658) has the molecular formula C15H31N5 and a molecular weight of 281.45 g/mol. Its IUPAC name is (2R,3R,11R,12R,15Z)-2,3,11,12-tetramethyl-1,4,7,10,13-pentazacyclohexadeca-13,15-diene.
| Compound Name | (2R,3R,11R,12R,15Z)-2,3,11,12-tetramethyl-1,4,7,10,13-pentazacyclohexadeca-13,15-diene |
|---|---|
| PubChem CID | 59529658 |
| Molecular Formula | C15H31N5 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.26 |
| IUPAC Name | (2R,3R,11R,12R,15Z)-2,3,11,12-tetramethyl-1,4,7,10,13-pentazacyclohexadeca-13,15-diene |
| SMILES | C[C@H]1/N=C\C=C/N[C@H](C)[C@@H](C)NCCNCCN[C@@H]1C |
| InChI | InChI=1S/C15H31N5/c1-12-14(3)19-10-8-16-9-11-20-15(4)13(2)18-7-5-6-17-12/h5-7,12-17,19-20H,8-11H2,1-4H3/b6-5-,18-7-/t12-,13-,14-,15-/m1/s1 |
| InChIKey | CZCAYTCBYQACIC-VWEPNZFRSA-N |
| XLogP | 0.50 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |