C29H46N2O5 — CID 59531199
N-[(1R,2R)-1-(4-butoxyphenyl)-1-hydroxy-3-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-6-cyclohexyl-6-oxohexanamide (PubChem CID 59531199) has the molecular formula C29H46N2O5 and a molecular weight of 502.70 g/mol. Its IUPAC name is N-[(1R,2R)-1-(4-butoxyphenyl)-1-hydroxy-3-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-6-cyclohexyl-6-oxohexanamide.
| Compound Name | N-[(1R,2R)-1-(4-butoxyphenyl)-1-hydroxy-3-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-6-cyclohexyl-6-oxohexanamide |
|---|---|
| PubChem CID | 59531199 |
| Molecular Formula | C29H46N2O5 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | N-[(1R,2R)-1-(4-butoxyphenyl)-1-hydroxy-3-[(3S)-3-hydroxypyrrolidin-1-yl]propan-2-yl]-6-cyclohexyl-6-oxohexanamide |
| SMILES | CCCCOc1ccc([C@@H](O)[C@@H](CN2CC[C@H](O)C2)NC(=O)CCCCC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H46N2O5/c1-2-3-19-36-25-15-13-23(14-16-25)29(35)26(21-31-18-17-24(32)20-31)30-28(34)12-8-7-11-27(33)22-9-5-4-6-10-22/h13-16,22,24,26,29,32,35H,2-12,17-21H2,1H3,(H,30,34)/t24-,26+,29+/m0/s1 |
| InChIKey | RDGNWASEMUAHOP-IHTKTJBKSA-N |
| XLogP | 4.16 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|