C23H23F2N7O5 — CID 59531598
pyridin-3-yl 5-[2,6-difluoro-4-[(5S)-5-[(1,2-oxazol-3-ylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,2,5-triazepane-1-carboxylate (PubChem CID 59531598) has the molecular formula C23H23F2N7O5 and a molecular weight of 515.48 g/mol. Its IUPAC name is pyridin-3-yl 5-[2,6-difluoro-4-[(5S)-5-[(1,2-oxazol-3-ylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,2,5-triazepane-1-carboxylate.
| Compound Name | pyridin-3-yl 5-[2,6-difluoro-4-[(5S)-5-[(1,2-oxazol-3-ylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,2,5-triazepane-1-carboxylate |
|---|---|
| PubChem CID | 59531598 |
| Molecular Formula | C23H23F2N7O5 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | pyridin-3-yl 5-[2,6-difluoro-4-[(5S)-5-[(1,2-oxazol-3-ylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,2,5-triazepane-1-carboxylate |
| SMILES | O=C(Oc1cccnc1)N1CCN(c2c(F)cc(N3C[C@H](CNc4ccon4)OC3=O)cc2F)CCN1 |
| InChI | InChI=1S/C23H23F2N7O5/c24-18-10-15(31-14-17(37-22(31)33)13-27-20-3-9-35-29-20)11-19(25)21(18)30-6-5-28-32(8-7-30)23(34)36-16-2-1-4-26-12-16/h1-4,9-12,17,28H,5-8,13-14H2,(H,27,29)/t17-/m0/s1 |
| InChIKey | HCTQNFHWEWVYAL-KRWDZBQOSA-N |
| XLogP | 2.61 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|