C17H16ClFN4O2S — CID 59531907
4-[3-(chloromethyl)-5-[(3-methylphenyl)methyl]-1,2,4-triazol-1-yl]-3-fluorobenzenesulfonamide (PubChem CID 59531907) has the molecular formula C17H16ClFN4O2S and a molecular weight of 394.86 g/mol. Its IUPAC name is 4-[3-(chloromethyl)-5-[(3-methylphenyl)methyl]-1,2,4-triazol-1-yl]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[3-(chloromethyl)-5-[(3-methylphenyl)methyl]-1,2,4-triazol-1-yl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 59531907 |
| Molecular Formula | C17H16ClFN4O2S |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-[3-(chloromethyl)-5-[(3-methylphenyl)methyl]-1,2,4-triazol-1-yl]-3-fluorobenzenesulfonamide |
| SMILES | Cc1cccc(Cc2nc(CCl)nn2-c2ccc(S(N)(=O)=O)cc2F)c1 |
| InChI | InChI=1S/C17H16ClFN4O2S/c1-11-3-2-4-12(7-11)8-17-21-16(10-18)22-23(17)15-6-5-13(9-14(15)19)26(20,24)25/h2-7,9H,8,10H2,1H3,(H2,20,24,25) |
| InChIKey | AWQQGWAJUAQUNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|