About 7H-indolo[1,2-a]quinolin-12-ium
7H-indolo[1,2-a]quinolin-12-ium (PubChem CID 59532580) has the molecular formula C16H12N+
and a molecular weight of 218.28 g/mol. Its IUPAC name is 7H-indolo[1,2-a]quinolin-12-ium.
Molecular Properties
| Compound Name | 7H-indolo[1,2-a]quinolin-12-ium |
| PubChem CID | 59532580 |
| Molecular Formula | C16H12N+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 7H-indolo[1,2-a]quinolin-12-ium |
| SMILES | c1ccc2c(c1)Cc1ccc3ccccc3[n+]1-2 |
| InChI | InChI=1S/C16H12N/c1-3-7-15-12(5-1)9-10-14-11-13-6-2-4-8-16(13)17(14)15/h1-10H,11H2/q+1 |
| InChIKey | SPFCFXPVHFROGF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7H-indolo[1,2-a]quinolin-12-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-indolo[1,2-a]quinolin-12-ium?
The IUPAC name of 7H-indolo[1,2-a]quinolin-12-ium (CID 59532580) is 7H-indolo[1,2-a]quinolin-12-ium.
What is the SMILES notation for 7H-indolo[1,2-a]quinolin-12-ium?
The canonical SMILES for 7H-indolo[1,2-a]quinolin-12-ium is c1ccc2c(c1)Cc1ccc3ccccc3[n+]1-2.
What is the InChIKey of 7H-indolo[1,2-a]quinolin-12-ium?
The InChIKey is SPFCFXPVHFROGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N/c1-3-7-15-12(5-1)9-10-14-11-13-6-2-4-8-16(13)17(14)15/h1-10H,11H2/q+1.
What are the key properties of 7H-indolo[1,2-a]quinolin-12-ium?
7H-indolo[1,2-a]quinolin-12-ium has a molecular weight of 218.28 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-indolo[1,2-a]quinolin-12-ium is sourced from PubChem (CID 59532580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).