About propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate
propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate (PubChem CID 59532834) has the molecular formula C15H23NO5
and a molecular weight of 297.35 g/mol. Its IUPAC name is propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate |
| PubChem CID | 59532834 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCNC(=O)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C15H23NO5/c1-11(2)15(19)20-10-6-5-9-16-13(17)7-8-14(18)21-12(3)4/h7-8,12H,1,5-6,9-10H2,2-4H3,(H,16,17)/b8-7+ |
| InChIKey | AVCQOWXKDVVMSJ-BQYQJAHWSA-N |
| XLogP | 1.51 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate?
The IUPAC name of propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate (CID 59532834) is propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate.
What is the SMILES notation for propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate?
The canonical SMILES for propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate is C=C(C)C(=O)OCCCCNC(=O)/C=C/C(=O)OC(C)C.
What is the InChIKey of propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate?
The InChIKey is AVCQOWXKDVVMSJ-BQYQJAHWSA-N. The full InChI is InChI=1S/C15H23NO5/c1-11(2)15(19)20-10-6-5-9-16-13(17)7-8-14(18)21-12(3)4/h7-8,12H,1,5-6,9-10H2,2-4H3,(H,16,17)/b8-7+.
What are the key properties of propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate?
propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate has a molecular weight of 297.35 g/mol, XLogP of 1.51, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (E)-4-[4-(2-methylprop-2-enoyloxy)butylamino]-4-oxobut-2-enoate is sourced from PubChem (CID 59532834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).