C10H19NO2 — CID 59532945
N-(4-propan-2-yloxybutyl)prop-2-enamide (PubChem CID 59532945) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N-(4-propan-2-yloxybutyl)prop-2-enamide.
| Compound Name | N-(4-propan-2-yloxybutyl)prop-2-enamide |
|---|---|
| PubChem CID | 59532945 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-(4-propan-2-yloxybutyl)prop-2-enamide |
| SMILES | C=CC(=O)NCCCCOC(C)C |
| InChI | InChI=1S/C10H19NO2/c1-4-10(12)11-7-5-6-8-13-9(2)3/h4,9H,1,5-8H2,2-3H3,(H,11,12) |
| InChIKey | YDFGICNSEYNQPW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|