About 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate
1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate (PubChem CID 59532977) has the molecular formula C13H21NO5
and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate |
| PubChem CID | 59532977 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate |
| SMILES | C=C(C)C(=O)NCCOC(=O)CCC(=O)OC(C)C |
| InChI | InChI=1S/C13H21NO5/c1-9(2)13(17)14-7-8-18-11(15)5-6-12(16)19-10(3)4/h10H,1,5-8H2,2-4H3,(H,14,17) |
| InChIKey | RVWFSWHPBLQRRP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate?
The IUPAC name of 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate (CID 59532977) is 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate.
What is the SMILES notation for 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate?
The canonical SMILES for 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate is C=C(C)C(=O)NCCOC(=O)CCC(=O)OC(C)C.
What is the InChIKey of 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate?
The InChIKey is RVWFSWHPBLQRRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO5/c1-9(2)13(17)14-7-8-18-11(15)5-6-12(16)19-10(3)4/h10H,1,5-8H2,2-4H3,(H,14,17).
What are the key properties of 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate?
1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate has a molecular weight of 271.31 g/mol, XLogP of 0.95, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl butanedioate is sourced from PubChem (CID 59532977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).