About 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine
2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine (PubChem CID 59533509) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine |
| PubChem CID | 59533509 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine |
| SMILES | Cc1nc2ncc(CCN)cc2[nH]1 |
| InChI | InChI=1S/C9H12N4/c1-6-12-8-4-7(2-3-10)5-11-9(8)13-6/h4-5H,2-3,10H2,1H3,(H,11,12,13) |
| InChIKey | JJUPMINYFWUFKO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine?
The IUPAC name of 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine (CID 59533509) is 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine.
What is the SMILES notation for 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine?
The canonical SMILES for 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine is Cc1nc2ncc(CCN)cc2[nH]1.
What is the InChIKey of 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine?
The InChIKey is JJUPMINYFWUFKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-6-12-8-4-7(2-3-10)5-11-9(8)13-6/h4-5H,2-3,10H2,1H3,(H,11,12,13).
What are the key properties of 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine?
2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine has a molecular weight of 176.22 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethanamine is sourced from PubChem (CID 59533509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).