C27H30FNO2 — CID 59533568
(3S,4R,5R)-1-benzyl-3-(fluoromethyl)-4,5-bis(phenylmethoxy)piperidine (PubChem CID 59533568) has the molecular formula C27H30FNO2 and a molecular weight of 419.54 g/mol. Its IUPAC name is (3S,4R,5R)-1-benzyl-3-(fluoromethyl)-4,5-bis(phenylmethoxy)piperidine.
| Compound Name | (3S,4R,5R)-1-benzyl-3-(fluoromethyl)-4,5-bis(phenylmethoxy)piperidine |
|---|---|
| PubChem CID | 59533568 |
| Molecular Formula | C27H30FNO2 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (3S,4R,5R)-1-benzyl-3-(fluoromethyl)-4,5-bis(phenylmethoxy)piperidine |
| SMILES | FC[C@H]1CN(Cc2ccccc2)C[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30FNO2/c28-16-25-18-29(17-22-10-4-1-5-11-22)19-26(30-20-23-12-6-2-7-13-23)27(25)31-21-24-14-8-3-9-15-24/h1-15,25-27H,16-21H2/t25-,26+,27+/m0/s1 |
| InChIKey | WUAHZUXRSWHOGI-OYUWMTPXSA-N |
| XLogP | 5.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |