C23H46N4 — CID 59533653
[5-(aminomethyl)-2-[(Z)-heptadec-8-enyl]-4,6-dihydro-1H-pyrimidin-5-yl]methanamine (PubChem CID 59533653) has the molecular formula C23H46N4 and a molecular weight of 378.65 g/mol. Its IUPAC name is [5-(aminomethyl)-2-[(Z)-heptadec-8-enyl]-4,6-dihydro-1H-pyrimidin-5-yl]methanamine.
| Compound Name | [5-(aminomethyl)-2-[(Z)-heptadec-8-enyl]-4,6-dihydro-1H-pyrimidin-5-yl]methanamine |
|---|---|
| PubChem CID | 59533653 |
| Molecular Formula | C23H46N4 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 378.37 |
| IUPAC Name | [5-(aminomethyl)-2-[(Z)-heptadec-8-enyl]-4,6-dihydro-1H-pyrimidin-5-yl]methanamine |
| SMILES | CCCCCCCC/C=C\CCCCCCCC1=NCC(CN)(CN)CN1 |
| InChI | InChI=1S/C23H46N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-26-20-23(18-24,19-25)21-27-22/h9-10H,2-8,11-21,24-25H2,1H3,(H,26,27)/b10-9- |
| InChIKey | LDOZRDJXJXKHBR-KTKRTIGZSA-N |
| XLogP | 4.93 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|