About N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+)
N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+) (PubChem CID 59534028) has the molecular formula C8H10NO2RbS
and a molecular weight of 269.71 g/mol. Its IUPAC name is N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+).
Molecular Properties
| Compound Name | N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+) |
| PubChem CID | 59534028 |
| Molecular Formula | C8H10NO2RbS |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 268.96 |
| IUPAC Name | N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+) |
| SMILES | CNS(=O)(=O)c1c[c-]cc(C)c1.[Rb+] |
| InChI | InChI=1S/C8H10NO2S.Rb/c1-7-4-3-5-8(6-7)12(10,11)9-2;/h4-6,9H,1-2H3;/q-1;+1 |
| InChIKey | FIBDUOQSXSUTHR-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+)?
The IUPAC name of N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+) (CID 59534028) is N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+).
What is the SMILES notation for N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+)?
The canonical SMILES for N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+) is CNS(=O)(=O)c1c[c-]cc(C)c1.[Rb+].
What is the InChIKey of N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+)?
The InChIKey is FIBDUOQSXSUTHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NO2S.Rb/c1-7-4-3-5-8(6-7)12(10,11)9-2;/h4-6,9H,1-2H3;/q-1;+1.
What are the key properties of N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+)?
N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+) has a molecular weight of 269.71 g/mol, XLogP of -2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylbenzene-5-ide-1-sulfonamide;rubidium(1+) is sourced from PubChem (CID 59534028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).