C29H44FN5O3Si — CID 59534270
tert-butyl N-[5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]-N-[(2-fluorophenyl)methyl]carbamate (PubChem CID 59534270) has the molecular formula C29H44FN5O3Si and a molecular weight of 557.79 g/mol. Its IUPAC name is tert-butyl N-[5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]-N-[(2-fluorophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]-N-[(2-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 59534270 |
| Molecular Formula | C29H44FN5O3Si |
| Molecular Weight | 557.79 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | tert-butyl N-[5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]-N-[(2-fluorophenyl)methyl]carbamate |
| SMILES | CC(C)c1cnn2c(N(Cc3ccccc3F)C(=O)OC(C)(C)C)cc(NCCO[Si](C)(C)C(C)(C)C)nc12 |
| InChI | InChI=1S/C29H44FN5O3Si/c1-20(2)22-18-32-35-25(17-24(33-26(22)35)31-15-16-37-39(9,10)29(6,7)8)34(27(36)38-28(3,4)5)19-21-13-11-12-14-23(21)30/h11-14,17-18,20H,15-16,19H2,1-10H3,(H,31,33) |
| InChIKey | WYPPNRJBTSETSD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.79 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|