C22H31FN6 — CID 59534272
5-N-(6-aminohexyl)-7-N-[(2-fluorophenyl)methyl]-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5,7-diamine (PubChem CID 59534272) has the molecular formula C22H31FN6 and a molecular weight of 398.53 g/mol. Its IUPAC name is 5-N-(6-aminohexyl)-7-N-[(2-fluorophenyl)methyl]-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5,7-diamine.
| Compound Name | 5-N-(6-aminohexyl)-7-N-[(2-fluorophenyl)methyl]-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 59534272 |
| Molecular Formula | C22H31FN6 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 5-N-(6-aminohexyl)-7-N-[(2-fluorophenyl)methyl]-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5,7-diamine |
| SMILES | CC(C)c1cnn2c(NCc3ccccc3F)cc(NCCCCCCN)nc12 |
| InChI | InChI=1S/C22H31FN6/c1-16(2)18-15-27-29-21(26-14-17-9-5-6-10-19(17)23)13-20(28-22(18)29)25-12-8-4-3-7-11-24/h5-6,9-10,13,15-16,26H,3-4,7-8,11-12,14,24H2,1-2H3,(H,25,28) |
| InChIKey | DMPMAUSQDWOMRL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|