C28H36FN7O — CID 59534275
2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-8-pyrimidin-2-yloctan-1-ol (PubChem CID 59534275) has the molecular formula C28H36FN7O and a molecular weight of 505.64 g/mol. Its IUPAC name is 2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-8-pyrimidin-2-yloctan-1-ol.
| Compound Name | 2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-8-pyrimidin-2-yloctan-1-ol |
|---|---|
| PubChem CID | 59534275 |
| Molecular Formula | C28H36FN7O |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]-8-pyrimidin-2-yloctan-1-ol |
| SMILES | CC(C)c1cnn2c(NCc3ccccc3F)cc(NC(CO)CCCCCCc3ncccn3)nc12 |
| InChI | InChI=1S/C28H36FN7O/c1-20(2)23-18-33-36-27(32-17-21-10-7-8-12-24(21)29)16-26(35-28(23)36)34-22(19-37)11-5-3-4-6-13-25-30-14-9-15-31-25/h7-10,12,14-16,18,20,22,32,37H,3-6,11,13,17,19H2,1-2H3,(H,34,35) |
| InChIKey | VYBUJZLVVBWHSF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|