C23H33FN6O — CID 59534278
(2R)-7-amino-2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]heptan-1-ol (PubChem CID 59534278) has the molecular formula C23H33FN6O and a molecular weight of 428.56 g/mol. Its IUPAC name is (2R)-7-amino-2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]heptan-1-ol.
| Compound Name | (2R)-7-amino-2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]heptan-1-ol |
|---|---|
| PubChem CID | 59534278 |
| Molecular Formula | C23H33FN6O |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | (2R)-7-amino-2-[[7-[(2-fluorophenyl)methylamino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]amino]heptan-1-ol |
| SMILES | CC(C)c1cnn2c(NCc3ccccc3F)cc(N[C@@H](CO)CCCCCN)nc12 |
| InChI | InChI=1S/C23H33FN6O/c1-16(2)19-14-27-30-22(26-13-17-8-5-6-10-20(17)24)12-21(29-23(19)30)28-18(15-31)9-4-3-7-11-25/h5-6,8,10,12,14,16,18,26,31H,3-4,7,9,11,13,15,25H2,1-2H3,(H,28,29)/t18-/m1/s1 |
| InChIKey | ZEKWUYMSRXCIGE-GOSISDBHSA-N |
| XLogP | 3.90 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|